C21H30N4O4S — CID 168666231
tert-butyl 4-[5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 168666231) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is tert-butyl 4-[5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168666231 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | tert-butyl 4-[5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)nc2)C1 |
| InChI | InChI=1S/C21H30N4O4S/c1-15(26)30-14-16-11-19(27)25(13-16)17-5-6-18(22-12-17)23-7-9-24(10-8-23)20(28)29-21(2,3)4/h5-6,12,16H,7-11,13-14H2,1-4H3 |
| InChIKey | SDZOLYVJEWWEAP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|