C20H30N4O4S — CID 168666228
tert-butyl 4-[4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 168666228) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168666228 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl 4-[4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(=O)SCC1CC(=O)N(c2cnn(C3CCN(C(=O)OC(C)(C)C)CC3)c2)C1 |
| InChI | InChI=1S/C20H30N4O4S/c1-14(25)29-13-15-9-18(26)23(11-15)17-10-21-24(12-17)16-5-7-22(8-6-16)19(27)28-20(2,3)4/h10,12,15-16H,5-9,11,13H2,1-4H3 |
| InChIKey | XQCDSYUVFJGHKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|