C14H26N2O2S — CID 168666302
S-[[1-[3-(dimethylamino)-2,2-dimethylpropyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666302) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is S-[[1-[3-(dimethylamino)-2,2-dimethylpropyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-[3-(dimethylamino)-2,2-dimethylpropyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666302 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | S-[[1-[3-(dimethylamino)-2,2-dimethylpropyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(CC(C)(C)CN(C)C)C1 |
| InChI | InChI=1S/C14H26N2O2S/c1-11(17)19-8-12-6-13(18)16(7-12)10-14(2,3)9-15(4)5/h12H,6-10H2,1-5H3 |
| InChIKey | OLOPYFIXKIABKU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|