C13H19NO2S — CID 168665945
S-[[1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168665945) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is S-[[1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168665945 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | S-[[1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | C#CC(C)(CC)N1CC(CSC(C)=O)CC1=O |
| InChI | InChI=1S/C13H19NO2S/c1-5-13(4,6-2)14-8-11(7-12(14)16)9-17-10(3)15/h1,11H,6-9H2,2-4H3 |
| InChIKey | UWQYZNXZTBESRH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|