C16H26N2O4S — CID 168666213
tert-butyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-methylazetidine-1-carboxylate (PubChem CID 168666213) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is tert-butyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 168666213 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-methylazetidine-1-carboxylate |
| SMILES | CC(=O)SCC1CC(=O)N(C2(C)CN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C16H26N2O4S/c1-11(19)23-8-12-6-13(20)18(7-12)16(5)9-17(10-16)14(21)22-15(2,3)4/h12H,6-10H2,1-5H3 |
| InChIKey | XWTSZZISZQFIAC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|