C11H15NO2S — CID 168704606
S-[1-(2-methylbut-3-yn-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704606) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is S-[1-(2-methylbut-3-yn-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2-methylbut-3-yn-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704606 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | S-[1-(2-methylbut-3-yn-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | C#CC(C)(C)N1CC(SC(C)=O)CC1=O |
| InChI | InChI=1S/C11H15NO2S/c1-5-11(3,4)12-7-9(6-10(12)14)15-8(2)13/h1,9H,6-7H2,2-4H3 |
| InChIKey | GYLPFSHQOZQVKK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|