C16H20FNO3S — CID 168666449
S-[[1-(4-fluoro-2-propoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666449) has the molecular formula C16H20FNO3S and a molecular weight of 325.41 g/mol. Its IUPAC name is S-[[1-(4-fluoro-2-propoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(4-fluoro-2-propoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666449 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | S-[[1-(4-fluoro-2-propoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CCCOc1cc(F)ccc1N1CC(CSC(C)=O)CC1=O |
| InChI | InChI=1S/C16H20FNO3S/c1-3-6-21-15-8-13(17)4-5-14(15)18-9-12(7-16(18)20)10-22-11(2)19/h4-5,8,12H,3,6-7,9-10H2,1-2H3 |
| InChIKey | VOTBNPZCPRAWSM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|