C14H13ClN2O2S — CID 168668662
S-[[1-(3-chloro-5-cyanophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668662) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is S-[[1-(3-chloro-5-cyanophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(3-chloro-5-cyanophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668662 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | S-[[1-(3-chloro-5-cyanophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2cc(Cl)cc(C#N)c2)C1 |
| InChI | InChI=1S/C14H13ClN2O2S/c1-9(18)20-8-11-4-14(19)17(7-11)13-3-10(6-16)2-12(15)5-13/h2-3,5,11H,4,7-8H2,1H3 |
| InChIKey | DCFGKNZLYYAXKW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|