C11H13NO3S2 — CID 168670063
methyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate (PubChem CID 168670063) has the molecular formula C11H13NO3S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 168670063 |
| Molecular Formula | C11H13NO3S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | methyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C11H13NO3S2/c1-15-11(14)8-2-3-17-10(8)12-5-7(6-16)4-9(12)13/h2-3,7,16H,4-6H2,1H3 |
| InChIKey | BZBWDJILZYXAHI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|