C8H12N4OS2 — CID 168670309
1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168670309) has the molecular formula C8H12N4OS2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168670309 |
| Molecular Formula | C8H12N4OS2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | CSc1n[nH]c(N2CC(CS)CC2=O)n1 |
| InChI | InChI=1S/C8H12N4OS2/c1-15-8-9-7(10-11-8)12-3-5(4-14)2-6(12)13/h5,14H,2-4H2,1H3,(H,9,10,11) |
| InChIKey | WYSYOIWSBNQVPG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|