C13H15N3OS — CID 168670582
1-(4-methyl-1H-benzimidazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168670582) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-(4-methyl-1H-benzimidazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-methyl-1H-benzimidazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168670582 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-(4-methyl-1H-benzimidazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | Cc1cccc2[nH]c(N3CC(CS)CC3=O)nc12 |
| InChI | InChI=1S/C13H15N3OS/c1-8-3-2-4-10-12(8)15-13(14-10)16-6-9(7-18)5-11(16)17/h2-4,9,18H,5-7H2,1H3,(H,14,15) |
| InChIKey | ZTSOSKTUEQHTTJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|