C10H9N5OS — CID 168672280
2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-imidazole-4,5-dicarbonitrile (PubChem CID 168672280) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-imidazole-4,5-dicarbonitrile.
| Compound Name | 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 168672280 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1nc(N2CC(CS)CC2=O)[nH]c1C#N |
| InChI | InChI=1S/C10H9N5OS/c11-2-7-8(3-12)14-10(13-7)15-4-6(5-17)1-9(15)16/h6,17H,1,4-5H2,(H,13,14) |
| InChIKey | IDHKKUMASGFXQC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|