C13H13NO3S2 — CID 168670828
1-(1,1-dioxo-1-benzothiophen-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168670828) has the molecular formula C13H13NO3S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-(1,1-dioxo-1-benzothiophen-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(1,1-dioxo-1-benzothiophen-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168670828 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 1-(1,1-dioxo-1-benzothiophen-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1C1=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H13NO3S2/c15-13-5-9(7-18)6-14(13)11-8-19(16,17)12-4-2-1-3-10(11)12/h1-4,8-9,18H,5-7H2 |
| InChIKey | KUEDAIVYZZVTTD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|