C16H21ClN2O4S — CID 168674395
[1-[4-(morpholin-4-ylmethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674395) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is [1-[4-(morpholin-4-ylmethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[4-(morpholin-4-ylmethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674395 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [1-[4-(morpholin-4-ylmethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C16H21ClN2O4S/c17-24(21,22)12-14-9-16(20)19(11-14)15-3-1-13(2-4-15)10-18-5-7-23-8-6-18/h1-4,14H,5-12H2 |
| InChIKey | DFYFCVXHASSOLL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |