C10H17FNO7PS — CID 168674634
2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-[hydroxy(methyl)phosphoryl]butanoic acid (PubChem CID 168674634) has the molecular formula C10H17FNO7PS and a molecular weight of 345.29 g/mol. Its IUPAC name is 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-[hydroxy(methyl)phosphoryl]butanoic acid.
| Compound Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-[hydroxy(methyl)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 168674634 |
| Molecular Formula | C10H17FNO7PS |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-[hydroxy(methyl)phosphoryl]butanoic acid |
| SMILES | CP(=O)(O)CCC(C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H17FNO7PS/c1-20(16,17)3-2-8(10(14)15)12-5-7(4-9(12)13)6-21(11,18)19/h7-8H,2-6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | HTQQOEHHCWQQLT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|