C8H12FNO5S — CID 168674665
2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid (PubChem CID 168674665) has the molecular formula C8H12FNO5S and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid.
| Compound Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 168674665 |
| Molecular Formula | C8H12FNO5S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C8H12FNO5S/c1-5(8(12)13)10-3-6(2-7(10)11)4-16(9,14)15/h5-6H,2-4H2,1H3,(H,12,13) |
| InChIKey | GMXPUZIXZXXNEL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |