C10H12FNO5S — CID 168674661
(2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-ynoic acid (PubChem CID 168674661) has the molecular formula C10H12FNO5S and a molecular weight of 277.27 g/mol. Its IUPAC name is (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-ynoic acid.
| Compound Name | (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 168674661 |
| Molecular Formula | C10H12FNO5S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-ynoic acid |
| SMILES | C#CC[C@@H](C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H12FNO5S/c1-2-3-8(10(14)15)12-5-7(4-9(12)13)6-18(11,16)17/h1,7-8H,3-6H2,(H,14,15)/t7?,8-/m0/s1 |
| InChIKey | IHKHPTQXFHHSNI-MQWKRIRWSA-N |
| XLogP | -0.39 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|