C11H18FNO5S — CID 168674708
(2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylpentanoic acid (PubChem CID 168674708) has the molecular formula C11H18FNO5S and a molecular weight of 295.33 g/mol. Its IUPAC name is (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 168674708 |
| Molecular Formula | C11H18FNO5S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (2S)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H18FNO5S/c1-7(2)3-9(11(15)16)13-5-8(4-10(13)14)6-19(12,17)18/h7-9H,3-6H2,1-2H3,(H,15,16)/t8?,9-/m0/s1 |
| InChIKey | OAYADJRVALFVHT-GKAPJAKFSA-N |
| XLogP | 0.63 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |