C9H14FNO6S — CID 168674619
2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-hydroxybutanoic acid (PubChem CID 168674619) has the molecular formula C9H14FNO6S and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-hydroxybutanoic acid.
| Compound Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 168674619 |
| Molecular Formula | C9H14FNO6S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C9H14FNO6S/c1-5(12)8(9(14)15)11-3-6(2-7(11)13)4-18(10,16)17/h5-6,8,12H,2-4H2,1H3,(H,14,15) |
| InChIKey | ZQZZWAVFCBHDES-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |