C10H14FNO5S — CID 168674662
2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-enoic acid (PubChem CID 168674662) has the molecular formula C10H14FNO5S and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-enoic acid.
| Compound Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 168674662 |
| Molecular Formula | C10H14FNO5S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H14FNO5S/c1-2-3-8(10(14)15)12-5-7(4-9(12)13)6-18(11,16)17/h2,7-8H,1,3-6H2,(H,14,15) |
| InChIKey | CQPZAZKNIFMKAV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|