C11H16FNO3S — CID 168674783
[1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674783) has the molecular formula C11H16FNO3S and a molecular weight of 261.32 g/mol. Its IUPAC name is [1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674783 |
| Molecular Formula | C11H16FNO3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | [1-(3-methylpent-1-yn-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | C#CC(C)(CC)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H16FNO3S/c1-4-11(3,5-2)13-7-9(6-10(13)14)8-17(12,15)16/h1,9H,5-8H2,2-3H3 |
| InChIKey | OEIXSCMCGIFAKH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|