C10H18FNO3S — CID 168674803
(5-oxo-1-pentan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride (PubChem CID 168674803) has the molecular formula C10H18FNO3S and a molecular weight of 251.32 g/mol. Its IUPAC name is (5-oxo-1-pentan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride.
| Compound Name | (5-oxo-1-pentan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674803 |
| Molecular Formula | C10H18FNO3S |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (5-oxo-1-pentan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride |
| SMILES | CCCC(C)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H18FNO3S/c1-3-4-8(2)12-6-9(5-10(12)13)7-16(11,14)15/h8-9H,3-7H2,1-2H3 |
| InChIKey | VHRNDNHIBSFECI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |