C15H20FNO4S — CID 168674785
[1-(4-butan-2-yloxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674785) has the molecular formula C15H20FNO4S and a molecular weight of 329.39 g/mol. Its IUPAC name is [1-(4-butan-2-yloxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(4-butan-2-yloxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674785 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [1-(4-butan-2-yloxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCC(C)Oc1ccc(N2CC(CS(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C15H20FNO4S/c1-3-11(2)21-14-6-4-13(5-7-14)17-9-12(8-15(17)18)10-22(16,19)20/h4-7,11-12H,3,8-10H2,1-2H3 |
| InChIKey | MXFHEJLMQMPMAV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |