C15H19FN2O5S — CID 168675257
[1-[5-methoxy-2-(propanoylamino)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675257) has the molecular formula C15H19FN2O5S and a molecular weight of 358.39 g/mol. Its IUPAC name is [1-[5-methoxy-2-(propanoylamino)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[5-methoxy-2-(propanoylamino)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675257 |
| Molecular Formula | C15H19FN2O5S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [1-[5-methoxy-2-(propanoylamino)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCC(=O)Nc1ccc(OC)cc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C15H19FN2O5S/c1-3-14(19)17-12-5-4-11(23-2)7-13(12)18-8-10(6-15(18)20)9-24(16,21)22/h4-5,7,10H,3,6,8-9H2,1-2H3,(H,17,19) |
| InChIKey | AMPQTWMAIFEODP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |