C13H23FN2O3S — CID 168675276
[5-oxo-1-(1-propylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675276) has the molecular formula C13H23FN2O3S and a molecular weight of 306.40 g/mol. Its IUPAC name is [5-oxo-1-(1-propylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [5-oxo-1-(1-propylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675276 |
| Molecular Formula | C13H23FN2O3S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [5-oxo-1-(1-propylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCCN1CCC(N2CC(CS(=O)(=O)F)CC2=O)CC1 |
| InChI | InChI=1S/C13H23FN2O3S/c1-2-5-15-6-3-12(4-7-15)16-9-11(8-13(16)17)10-20(14,18)19/h11-12H,2-10H2,1H3 |
| InChIKey | MSYADNTZHTUQHL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |