C12H24FN3O3S — CID 168675467
[1-[3-[3-aminopropyl(methyl)amino]propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675467) has the molecular formula C12H24FN3O3S and a molecular weight of 309.41 g/mol. Its IUPAC name is [1-[3-[3-aminopropyl(methyl)amino]propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[3-[3-aminopropyl(methyl)amino]propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675467 |
| Molecular Formula | C12H24FN3O3S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [1-[3-[3-aminopropyl(methyl)amino]propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CN(CCCN)CCCN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H24FN3O3S/c1-15(5-2-4-14)6-3-7-16-9-11(8-12(16)17)10-20(13,18)19/h11H,2-10,14H2,1H3 |
| InChIKey | KLPINJXGTXHVNP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |