C12H22F3N3O3S — CID 154740482
N-[3-[(3S,4S)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]propyl]acetamide (PubChem CID 154740482) has the molecular formula C12H22F3N3O3S and a molecular weight of 345.39 g/mol. Its IUPAC name is N-[3-[(3S,4S)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]propyl]acetamide.
| Compound Name | N-[3-[(3S,4S)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 154740482 |
| Molecular Formula | C12H22F3N3O3S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[3-[(3S,4S)-3-(dimethylsulfamoyl)-4-(trifluoromethyl)pyrrolidin-1-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCN1C[C@@H](C(F)(F)F)[C@H](S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C12H22F3N3O3S/c1-9(19)16-5-4-6-18-7-10(12(13,14)15)11(8-18)22(20,21)17(2)3/h10-11H,4-8H2,1-3H3,(H,16,19)/t10-,11-/m1/s1 |
| InChIKey | NXTLSHPIRPXMNT-GHMZBOCLSA-N |
| XLogP | 0.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|