C14H18FNO3S2 — CID 168676424
[5-oxo-1-(3-phenylsulfanylpropyl)pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676424) has the molecular formula C14H18FNO3S2 and a molecular weight of 331.43 g/mol. Its IUPAC name is [5-oxo-1-(3-phenylsulfanylpropyl)pyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [5-oxo-1-(3-phenylsulfanylpropyl)pyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676424 |
| Molecular Formula | C14H18FNO3S2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [5-oxo-1-(3-phenylsulfanylpropyl)pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1CCCSc1ccccc1 |
| InChI | InChI=1S/C14H18FNO3S2/c15-21(18,19)11-12-9-14(17)16(10-12)7-4-8-20-13-5-2-1-3-6-13/h1-3,5-6,12H,4,7-11H2 |
| InChIKey | UYDVZXMHIZERKX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|