C16H21FN2O4S — CID 168676614
[1-[(2-morpholin-4-ylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676614) has the molecular formula C16H21FN2O4S and a molecular weight of 356.42 g/mol. Its IUPAC name is [1-[(2-morpholin-4-ylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[(2-morpholin-4-ylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676614 |
| Molecular Formula | C16H21FN2O4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [1-[(2-morpholin-4-ylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1Cc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C16H21FN2O4S/c17-24(21,22)12-13-9-16(20)19(10-13)11-14-3-1-2-4-15(14)18-5-7-23-8-6-18/h1-4,13H,5-12H2 |
| InChIKey | YGFHLMFARGRLQL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |