C14H16FN3O3S — CID 168676551
[1-[2-(benzimidazol-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676551) has the molecular formula C14H16FN3O3S and a molecular weight of 325.36 g/mol. Its IUPAC name is [1-[2-(benzimidazol-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[2-(benzimidazol-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676551 |
| Molecular Formula | C14H16FN3O3S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [1-[2-(benzimidazol-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1CCn1cnc2ccccc21 |
| InChI | InChI=1S/C14H16FN3O3S/c15-22(20,21)9-11-7-14(19)17(8-11)5-6-18-10-16-12-3-1-2-4-13(12)18/h1-4,10-11H,5-9H2 |
| InChIKey | GHRNTSZOSBLENN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |