About [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676687) has the molecular formula C9H11FN2O4S
and a molecular weight of 262.26 g/mol. Its IUPAC name is [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168676687 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1Cc1cnco1 |
| InChI | InChI=1S/C9H11FN2O4S/c10-17(14,15)5-7-1-9(13)12(3-7)4-8-2-11-6-16-8/h2,6-7H,1,3-5H2 |
| InChIKey | LIKBPZMHSRVBPY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168676687) is [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is O=C1CC(CS(=O)(=O)F)CN1Cc1cnco1.
What is the InChIKey of [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is LIKBPZMHSRVBPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O4S/c10-17(14,15)5-7-1-9(13)12(3-7)4-8-2-11-6-16-8/h2,6-7H,1,3-5H2.
What are the key properties of [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 262.26 g/mol, XLogP of 0.32, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-oxazol-5-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168676687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).