C8H17N3O4S — CID 168681848
[1-(3-amino-2-hydroxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681848) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is [1-(3-amino-2-hydroxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(3-amino-2-hydroxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681848 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [1-(3-amino-2-hydroxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NCC(O)CN1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C8H17N3O4S/c9-2-7(12)4-11-3-6(1-8(11)13)5-16(10,14)15/h6-7,12H,1-5,9H2,(H2,10,14,15) |
| InChIKey | UMUTUXUOEQOPGW-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |