C14H13N5O — CID 168684799
7-(4-ethenyl-2-oxopyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 168684799) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 7-(4-ethenyl-2-oxopyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-(4-ethenyl-2-oxopyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 168684799 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 7-(4-ethenyl-2-oxopyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | C=CC1CC(=O)N(c2c(C#N)cnc3cc(C)nn23)C1 |
| InChI | InChI=1S/C14H13N5O/c1-3-10-5-13(20)18(8-10)14-11(6-15)7-16-12-4-9(2)17-19(12)14/h3-4,7,10H,1,5,8H2,2H3 |
| InChIKey | HRXIAYWGSIVHLK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|