C11H10BrClN2O — CID 168686176
1-(3-bromo-5-chloro-2-pyridinyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168686176) has the molecular formula C11H10BrClN2O and a molecular weight of 301.57 g/mol. Its IUPAC name is 1-(3-bromo-5-chloro-2-pyridinyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(3-bromo-5-chloro-2-pyridinyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168686176 |
| Molecular Formula | C11H10BrClN2O |
| Molecular Weight | 301.57 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 1-(3-bromo-5-chloro-2-pyridinyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2ncc(Cl)cc2Br)C1 |
| InChI | InChI=1S/C11H10BrClN2O/c1-2-7-3-10(16)15(6-7)11-9(12)4-8(13)5-14-11/h2,4-5,7H,1,3,6H2 |
| InChIKey | CAWPKKDRSPKQFC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|