C11H9ClF3N3O — CID 168686598
1-[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]-4-ethenylpyrrolidin-2-one (PubChem CID 168686598) has the molecular formula C11H9ClF3N3O and a molecular weight of 291.66 g/mol. Its IUPAC name is 1-[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168686598 |
| Molecular Formula | C11H9ClF3N3O |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 1-[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nc(Cl)cc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C11H9ClF3N3O/c1-2-6-3-9(19)18(5-6)10-16-7(11(13,14)15)4-8(12)17-10/h2,4,6H,1,3,5H2 |
| InChIKey | UPZGIGLMRJGGFF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|