C12H13BrClNO2 — CID 168688031
1-(4-bromo-2-methoxy-5-methylphenyl)-4-chloropyrrolidin-2-one (PubChem CID 168688031) has the molecular formula C12H13BrClNO2 and a molecular weight of 318.60 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxy-5-methylphenyl)-4-chloropyrrolidin-2-one.
| Compound Name | 1-(4-bromo-2-methoxy-5-methylphenyl)-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168688031 |
| Molecular Formula | C12H13BrClNO2 |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 1-(4-bromo-2-methoxy-5-methylphenyl)-4-chloropyrrolidin-2-one |
| SMILES | COc1cc(Br)c(C)cc1N1CC(Cl)CC1=O |
| InChI | InChI=1S/C12H13BrClNO2/c1-7-3-10(11(17-2)5-9(7)13)15-6-8(14)4-12(15)16/h3,5,8H,4,6H2,1-2H3 |
| InChIKey | CUKMEAZKRBUPAU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|