C12H13FN2O3 — CID 168693863
methyl 1-(6-fluoro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168693863) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is methyl 1-(6-fluoro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(6-fluoro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168693863 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | methyl 1-(6-fluoro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cnc(F)cc2C)C1 |
| InChI | InChI=1S/C12H13FN2O3/c1-7-3-10(13)14-5-9(7)15-6-8(4-11(15)16)12(17)18-2/h3,5,8H,4,6H2,1-2H3 |
| InChIKey | ABVJCLHUBDOZMI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|