C8H8Cl2N4O — CID 168700417
4-amino-1-(4,6-dichloropyrimidin-5-yl)pyrrolidin-2-one (PubChem CID 168700417) has the molecular formula C8H8Cl2N4O and a molecular weight of 247.08 g/mol. Its IUPAC name is 4-amino-1-(4,6-dichloropyrimidin-5-yl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(4,6-dichloropyrimidin-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168700417 |
| Molecular Formula | C8H8Cl2N4O |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 4-amino-1-(4,6-dichloropyrimidin-5-yl)pyrrolidin-2-one |
| SMILES | NC1CC(=O)N(c2c(Cl)ncnc2Cl)C1 |
| InChI | InChI=1S/C8H8Cl2N4O/c9-7-6(8(10)13-3-12-7)14-2-4(11)1-5(14)15/h3-4H,1-2,11H2 |
| InChIKey | YTWZUWLQKIQNCI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |