C20H29N3O4 — CID 168701779
tert-butyl 4-[2-(4-hydroxy-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate (PubChem CID 168701779) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-hydroxy-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-hydroxy-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168701779 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl 4-[2-(4-hydroxy-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccccc2N2CC(O)CC2=O)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-20(2,3)27-19(26)22-10-8-14(9-11-22)21-16-6-4-5-7-17(16)23-13-15(24)12-18(23)25/h4-7,14-15,21,24H,8-13H2,1-3H3 |
| InChIKey | GCHOBSJUBGOBKK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |