C22H29N3O3 — CID 168500234
tert-butyl 4-[2-(4-ethynyl-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate (PubChem CID 168500234) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-ethynyl-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-ethynyl-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168500234 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl 4-[2-(4-ethynyl-2-oxopyrrolidin-1-yl)anilino]piperidine-1-carboxylate |
| SMILES | C#CC1CC(=O)N(c2ccccc2NC2CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-5-16-14-20(26)25(15-16)19-9-7-6-8-18(19)23-17-10-12-24(13-11-17)21(27)28-22(2,3)4/h1,6-9,16-17,23H,10-15H2,2-4H3 |
| InChIKey | VDRWIWIQVVASAN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|