C12H10BrF3N2O2S — CID 168706691
S-[1-[5-bromo-6-(trifluoromethyl)-2-pyridinyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168706691) has the molecular formula C12H10BrF3N2O2S and a molecular weight of 383.19 g/mol. Its IUPAC name is S-[1-[5-bromo-6-(trifluoromethyl)-2-pyridinyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[5-bromo-6-(trifluoromethyl)-2-pyridinyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168706691 |
| Molecular Formula | C12H10BrF3N2O2S |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | S-[1-[5-bromo-6-(trifluoromethyl)-2-pyridinyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(Br)c(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C12H10BrF3N2O2S/c1-6(19)21-7-4-10(20)18(5-7)9-3-2-8(13)11(17-9)12(14,15)16/h2-3,7H,4-5H2,1H3 |
| InChIKey | RJLKVMOOOAPMDM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|