C14H12ClN3O3S — CID 168707477
S-[1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707477) has the molecular formula C14H12ClN3O3S and a molecular weight of 337.79 g/mol. Its IUPAC name is S-[1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707477 |
| Molecular Formula | C14H12ClN3O3S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | S-[1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2nnc(-c3ccc(Cl)cc3)o2)C1 |
| InChI | InChI=1S/C14H12ClN3O3S/c1-8(19)22-11-6-12(20)18(7-11)14-17-16-13(21-14)9-2-4-10(15)5-3-9/h2-5,11H,6-7H2,1H3 |
| InChIKey | DVDLQJIAQMMKKO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|