C13H14BrNO3S — CID 168708231
ethyl 3-bromo-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoate (PubChem CID 168708231) has the molecular formula C13H14BrNO3S and a molecular weight of 344.23 g/mol. Its IUPAC name is ethyl 3-bromo-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoate.
| Compound Name | ethyl 3-bromo-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168708231 |
| Molecular Formula | C13H14BrNO3S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | ethyl 3-bromo-4-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CC(S)CC2=O)c(Br)c1 |
| InChI | InChI=1S/C13H14BrNO3S/c1-2-18-13(17)8-3-4-11(10(14)5-8)15-7-9(19)6-12(15)16/h3-5,9,19H,2,6-7H2,1H3 |
| InChIKey | PHJPTWHFQFFIND-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|