C12H16N2OS2 — CID 168709435
1-[2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168709435) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 1-[2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709435 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-[2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1CCc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C12H16N2OS2/c15-12-6-8(16)7-14(12)5-4-11-13-9-2-1-3-10(9)17-11/h8,16H,1-7H2 |
| InChIKey | JVYRSWWJBAUAFK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|