C12H11ClN2O3S — CID 168712705
1-[2-(cyanomethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712705) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is 1-[2-(cyanomethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-[2-(cyanomethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712705 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 1-[2-(cyanomethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | N#CCc1ccccc1N1CC(S(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C12H11ClN2O3S/c13-19(17,18)10-7-12(16)15(8-10)11-4-2-1-3-9(11)5-6-14/h1-4,10H,5,7-8H2 |
| InChIKey | YIVGRPRDSINEBM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |