C11H9ClN2O4S — CID 168712947
1-(1,3-benzoxazol-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712947) has the molecular formula C11H9ClN2O4S and a molecular weight of 300.72 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712947 |
| Molecular Formula | C11H9ClN2O4S |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H9ClN2O4S/c12-19(16,17)7-5-10(15)14(6-7)11-13-8-3-1-2-4-9(8)18-11/h1-4,7H,5-6H2 |
| InChIKey | GYMRLMPHWPYLCW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |