C16H19F2NO3S — CID 168714779
1-[[1-(2-fluorophenyl)cyclopentyl]methyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714779) has the molecular formula C16H19F2NO3S and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[[1-(2-fluorophenyl)cyclopentyl]methyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[[1-(2-fluorophenyl)cyclopentyl]methyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714779 |
| Molecular Formula | C16H19F2NO3S |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[[1-(2-fluorophenyl)cyclopentyl]methyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1CC1(c2ccccc2F)CCCC1 |
| InChI | InChI=1S/C16H19F2NO3S/c17-14-6-2-1-5-13(14)16(7-3-4-8-16)11-19-10-12(9-15(19)20)23(18,21)22/h1-2,5-6,12H,3-4,7-11H2 |
| InChIKey | VWJKQUVGKAGBSJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |