C10H20FN3O3S — CID 168714820
1-[3-(3-aminopropylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714820) has the molecular formula C10H20FN3O3S and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-[3-(3-aminopropylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[3-(3-aminopropylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714820 |
| Molecular Formula | C10H20FN3O3S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[3-(3-aminopropylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | NCCCNCCCN1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H20FN3O3S/c11-18(16,17)9-7-10(15)14(8-9)6-2-5-13-4-1-3-12/h9,13H,1-8,12H2 |
| InChIKey | KGPWCQWKMVQYGI-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|