C11H10BrF3N2O3S — CID 168719237
1-[3-bromo-5-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719237) has the molecular formula C11H10BrF3N2O3S and a molecular weight of 387.18 g/mol. Its IUPAC name is 1-[3-bromo-5-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719237 |
| Molecular Formula | C11H10BrF3N2O3S |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cc(Br)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C11H10BrF3N2O3S/c12-7-1-6(11(13,14)15)2-8(3-7)17-5-9(4-10(17)18)21(16,19)20/h1-3,9H,4-5H2,(H2,16,19,20) |
| InChIKey | LDHTZHNAJJLHJX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |