About 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide
1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719500) has the molecular formula C13H13N3O4S2
and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide |
| PubChem CID | 168719500 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2nc(-c3ccc(O)cc3)cs2)C1 |
| InChI | InChI=1S/C13H13N3O4S2/c14-22(19,20)10-5-12(18)16(6-10)13-15-11(7-21-13)8-1-3-9(17)4-2-8/h1-4,7,10,17H,5-6H2,(H2,14,19,20) |
| InChIKey | YJXVZTCABGJRRR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide?
The IUPAC name of 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide (CID 168719500) is 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide.
What is the SMILES notation for 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide?
The canonical SMILES for 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide is NS(=O)(=O)C1CC(=O)N(c2nc(-c3ccc(O)cc3)cs2)C1.
What is the InChIKey of 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide?
The InChIKey is YJXVZTCABGJRRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4S2/c14-22(19,20)10-5-12(18)16(6-10)13-15-11(7-21-13)8-1-3-9(17)4-2-8/h1-4,7,10,17H,5-6H2,(H2,14,19,20).
What are the key properties of 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide?
1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide has a molecular weight of 339.40 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide is sourced from PubChem (CID 168719500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).