C13H13N3O4S2 — CID 168719500
1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719500) has the molecular formula C13H13N3O4S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719500 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2nc(-c3ccc(O)cc3)cs2)C1 |
| InChI | InChI=1S/C13H13N3O4S2/c14-22(19,20)10-5-12(18)16(6-10)13-15-11(7-21-13)8-1-3-9(17)4-2-8/h1-4,7,10,17H,5-6H2,(H2,14,19,20) |
| InChIKey | YJXVZTCABGJRRR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |